C14H14BrN3OS — CID 71895290
2-[[1-[(5-bromothiophen-3-yl)methyl]benzimidazol-2-yl]amino]ethanol (PubChem CID 71895290) has the molecular formula C14H14BrN3OS and a molecular weight of 352.26 g/mol. Its IUPAC name is 2-[[1-[(5-bromothiophen-3-yl)methyl]benzimidazol-2-yl]amino]ethanol.
| Compound Name | 2-[[1-[(5-bromothiophen-3-yl)methyl]benzimidazol-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 71895290 |
| Molecular Formula | C14H14BrN3OS |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 2-[[1-[(5-bromothiophen-3-yl)methyl]benzimidazol-2-yl]amino]ethanol |
| SMILES | OCCNc1nc2ccccc2n1Cc1csc(Br)c1 |
| InChI | InChI=1S/C14H14BrN3OS/c15-13-7-10(9-20-13)8-18-12-4-2-1-3-11(12)17-14(18)16-5-6-19/h1-4,7,9,19H,5-6,8H2,(H,16,17) |
| InChIKey | OTAJYVKDUYQBIQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |