C24H22ClN5O2 — CID 166184378
2-(6-chloroindol-1-yl)-N-[[3-(pyridin-4-ylmethylcarbamoylamino)phenyl]methyl]acetamide (PubChem CID 166184378) has the molecular formula C24H22ClN5O2 and a molecular weight of 447.93 g/mol. Its IUPAC name is 2-(6-chloroindol-1-yl)-N-[[3-(pyridin-4-ylmethylcarbamoylamino)phenyl]methyl]acetamide.
| Compound Name | 2-(6-chloroindol-1-yl)-N-[[3-(pyridin-4-ylmethylcarbamoylamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 166184378 |
| Molecular Formula | C24H22ClN5O2 |
| Molecular Weight | 447.93 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-(6-chloroindol-1-yl)-N-[[3-(pyridin-4-ylmethylcarbamoylamino)phenyl]methyl]acetamide |
| SMILES | O=C(Cn1ccc2ccc(Cl)cc21)NCc1cccc(NC(=O)NCc2ccncc2)c1 |
| InChI | InChI=1S/C24H22ClN5O2/c25-20-5-4-19-8-11-30(22(19)13-20)16-23(31)27-15-18-2-1-3-21(12-18)29-24(32)28-14-17-6-9-26-10-7-17/h1-13H,14-16H2,(H,27,31)(H2,28,29,32) |
| InChIKey | FGDTYKOWYKECSG-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.93 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |