C21H19ClN4O — CID 55997984
2-(6-chloroindol-1-yl)-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide (PubChem CID 55997984) has the molecular formula C21H19ClN4O and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-(6-chloroindol-1-yl)-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide.
| Compound Name | 2-(6-chloroindol-1-yl)-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 55997984 |
| Molecular Formula | C21H19ClN4O |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 2-(6-chloroindol-1-yl)-N-[[2-(pyrazol-1-ylmethyl)phenyl]methyl]acetamide |
| SMILES | O=C(Cn1ccc2ccc(Cl)cc21)NCc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C21H19ClN4O/c22-19-7-6-16-8-11-25(20(16)12-19)15-21(27)23-13-17-4-1-2-5-18(17)14-26-10-3-9-24-26/h1-12H,13-15H2,(H,23,27) |
| InChIKey | YKLDMOLLIWVXED-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |