C18H17ClN2O2 — CID 39351923
2-(5-chloroindol-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 39351923) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is 2-(5-chloroindol-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(5-chloroindol-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 39351923 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 2-(5-chloroindol-1-yl)-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccccc1CNC(=O)Cn1ccc2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H17ClN2O2/c1-23-17-5-3-2-4-14(17)11-20-18(22)12-21-9-8-13-10-15(19)6-7-16(13)21/h2-10H,11-12H2,1H3,(H,20,22) |
| InChIKey | GUSMIKYJNBWJJF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |