C16H17IN2O3 — CID 71909112
2-(5-iodo-3-methyl-2-oxo-1-pyridinyl)-N-[(2-methoxyphenyl)methyl]acetamide (PubChem CID 71909112) has the molecular formula C16H17IN2O3 and a molecular weight of 412.23 g/mol. Its IUPAC name is 2-(5-iodo-3-methyl-2-oxo-1-pyridinyl)-N-[(2-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(5-iodo-3-methyl-2-oxo-1-pyridinyl)-N-[(2-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 71909112 |
| Molecular Formula | C16H17IN2O3 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 2-(5-iodo-3-methyl-2-oxo-1-pyridinyl)-N-[(2-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccccc1CNC(=O)Cn1cc(I)cc(C)c1=O |
| InChI | InChI=1S/C16H17IN2O3/c1-11-7-13(17)9-19(16(11)21)10-15(20)18-8-12-5-3-4-6-14(12)22-2/h3-7,9H,8,10H2,1-2H3,(H,18,20) |
| InChIKey | BJXYLIFYIZDENK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|