C22H19N3O5 — CID 166185327
methyl 5-[[4-(4-cyano-2-methoxyphenoxy)phenyl]carbamoyl]-1-methylpyrrole-2-carboxylate (PubChem CID 166185327) has the molecular formula C22H19N3O5 and a molecular weight of 405.41 g/mol. Its IUPAC name is methyl 5-[[4-(4-cyano-2-methoxyphenoxy)phenyl]carbamoyl]-1-methylpyrrole-2-carboxylate.
| Compound Name | methyl 5-[[4-(4-cyano-2-methoxyphenoxy)phenyl]carbamoyl]-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 166185327 |
| Molecular Formula | C22H19N3O5 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | methyl 5-[[4-(4-cyano-2-methoxyphenoxy)phenyl]carbamoyl]-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccc(Oc3ccc(C#N)cc3OC)cc2)n1C |
| InChI | InChI=1S/C22H19N3O5/c1-25-17(9-10-18(25)22(27)29-3)21(26)24-15-5-7-16(8-6-15)30-19-11-4-14(13-23)12-20(19)28-2/h4-12H,1-3H3,(H,24,26) |
| InChIKey | LQVUWDGGYQGARG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |