C19H17F3N2O4 — CID 52850188
N-[4-(4-cyano-2-methoxyphenoxy)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 52850188) has the molecular formula C19H17F3N2O4 and a molecular weight of 394.35 g/mol. Its IUPAC name is N-[4-(4-cyano-2-methoxyphenoxy)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[4-(4-cyano-2-methoxyphenoxy)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 52850188 |
| Molecular Formula | C19H17F3N2O4 |
| Molecular Weight | 394.35 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-[4-(4-cyano-2-methoxyphenoxy)phenyl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | COc1cc(C#N)ccc1Oc1ccc(NC(=O)CCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H17F3N2O4/c1-26-17-10-13(11-23)2-7-16(17)28-15-5-3-14(4-6-15)24-18(25)8-9-27-12-19(20,21)22/h2-7,10H,8-9,12H2,1H3,(H,24,25) |
| InChIKey | XAZMMPRQLNVOIJ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 80.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|