C21H18F3N3O4S — CID 55721831
4-(4-cyano-2-methoxyphenoxy)-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]butanamide (PubChem CID 55721831) has the molecular formula C21H18F3N3O4S and a molecular weight of 465.45 g/mol. Its IUPAC name is 4-(4-cyano-2-methoxyphenoxy)-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]butanamide.
| Compound Name | 4-(4-cyano-2-methoxyphenoxy)-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 55721831 |
| Molecular Formula | C21H18F3N3O4S |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 4-(4-cyano-2-methoxyphenoxy)-N-[6-(2,2,2-trifluoroethoxy)-1,3-benzothiazol-2-yl]butanamide |
| SMILES | COc1cc(C#N)ccc1OCCCC(=O)Nc1nc2ccc(OCC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C21H18F3N3O4S/c1-29-17-9-13(11-25)4-7-16(17)30-8-2-3-19(28)27-20-26-15-6-5-14(10-18(15)32-20)31-12-21(22,23)24/h4-7,9-10H,2-3,8,12H2,1H3,(H,26,27,28) |
| InChIKey | BADNCDSIVKQCPA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|