C19H19N3O4S — CID 166187188
N-[4-[(8-methoxyquinolin-5-yl)sulfonylamino]-2-methylphenyl]acetamide (PubChem CID 166187188) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[4-[(8-methoxyquinolin-5-yl)sulfonylamino]-2-methylphenyl]acetamide.
| Compound Name | N-[4-[(8-methoxyquinolin-5-yl)sulfonylamino]-2-methylphenyl]acetamide |
|---|---|
| PubChem CID | 166187188 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[4-[(8-methoxyquinolin-5-yl)sulfonylamino]-2-methylphenyl]acetamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(NC(C)=O)c(C)c2)c2cccnc12 |
| InChI | InChI=1S/C19H19N3O4S/c1-12-11-14(6-7-16(12)21-13(2)23)22-27(24,25)18-9-8-17(26-3)19-15(18)5-4-10-20-19/h4-11,22H,1-3H3,(H,21,23) |
| InChIKey | ZOMARRBBFRJDKT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |