C15H20N4O — CID 166187417
1-(6-cyclopentyloxy-3-pyridinyl)-N-(1H-pyrazol-4-ylmethyl)methanamine (PubChem CID 166187417) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 1-(6-cyclopentyloxy-3-pyridinyl)-N-(1H-pyrazol-4-ylmethyl)methanamine.
| Compound Name | 1-(6-cyclopentyloxy-3-pyridinyl)-N-(1H-pyrazol-4-ylmethyl)methanamine |
|---|---|
| PubChem CID | 166187417 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 1-(6-cyclopentyloxy-3-pyridinyl)-N-(1H-pyrazol-4-ylmethyl)methanamine |
| SMILES | c1cc(OC2CCCC2)ncc1CNCc1cn[nH]c1 |
| InChI | InChI=1S/C15H20N4O/c1-2-4-14(3-1)20-15-6-5-12(9-17-15)7-16-8-13-10-18-19-11-13/h5-6,9-11,14,16H,1-4,7-8H2,(H,18,19) |
| InChIKey | LKSQBOQGJXPSEJ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |