C22H17N5O3S — CID 166189358
2-oxo-2-[2-(1-oxo-2H-isoquinolin-6-yl)hydrazinyl]-N-(4-pyridin-4-ylsulfanylphenyl)acetamide (PubChem CID 166189358) has the molecular formula C22H17N5O3S and a molecular weight of 431.48 g/mol. Its IUPAC name is 2-oxo-2-[2-(1-oxo-2H-isoquinolin-6-yl)hydrazinyl]-N-(4-pyridin-4-ylsulfanylphenyl)acetamide.
| Compound Name | 2-oxo-2-[2-(1-oxo-2H-isoquinolin-6-yl)hydrazinyl]-N-(4-pyridin-4-ylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 166189358 |
| Molecular Formula | C22H17N5O3S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 2-oxo-2-[2-(1-oxo-2H-isoquinolin-6-yl)hydrazinyl]-N-(4-pyridin-4-ylsulfanylphenyl)acetamide |
| SMILES | O=C(NNc1ccc2c(=O)[nH]ccc2c1)C(=O)Nc1ccc(Sc2ccncc2)cc1 |
| InChI | InChI=1S/C22H17N5O3S/c28-20-19-6-3-16(13-14(19)7-12-24-20)26-27-22(30)21(29)25-15-1-4-17(5-2-15)31-18-8-10-23-11-9-18/h1-13,26H,(H,24,28)(H,25,29)(H,27,30) |
| InChIKey | GHHAGGOKYDTTRU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|