C14H8Cl2N2O2S — CID 24863364
2,5-dichloro-N-(1-oxo-2H-isoquinolin-6-yl)thiophene-3-carboxamide (PubChem CID 24863364) has the molecular formula C14H8Cl2N2O2S and a molecular weight of 339.20 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-oxo-2H-isoquinolin-6-yl)thiophene-3-carboxamide.
| Compound Name | 2,5-dichloro-N-(1-oxo-2H-isoquinolin-6-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 24863364 |
| Molecular Formula | C14H8Cl2N2O2S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 2,5-dichloro-N-(1-oxo-2H-isoquinolin-6-yl)thiophene-3-carboxamide |
| SMILES | O=C(Nc1ccc2c(=O)[nH]ccc2c1)c1cc(Cl)sc1Cl |
| InChI | InChI=1S/C14H8Cl2N2O2S/c15-11-6-10(12(16)21-11)14(20)18-8-1-2-9-7(5-8)3-4-17-13(9)19/h1-6H,(H,17,19)(H,18,20) |
| InChIKey | PFYQBVCPMKTPSE-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |