C20H18N6O4 — CID 166190072
5-N-[3-(2,5-dioxoimidazolidin-1-yl)phenyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide (PubChem CID 166190072) has the molecular formula C20H18N6O4 and a molecular weight of 406.40 g/mol. Its IUPAC name is 5-N-[3-(2,5-dioxoimidazolidin-1-yl)phenyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide.
| Compound Name | 5-N-[3-(2,5-dioxoimidazolidin-1-yl)phenyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
|---|---|
| PubChem CID | 166190072 |
| Molecular Formula | C20H18N6O4 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 5-N-[3-(2,5-dioxoimidazolidin-1-yl)phenyl]-2-phenyl-3,4-dihydropyrazole-3,5-dicarboxamide |
| SMILES | NC(=O)C1CC(C(=O)Nc2cccc(N3C(=O)CNC3=O)c2)=NN1c1ccccc1 |
| InChI | InChI=1S/C20H18N6O4/c21-18(28)16-10-15(24-26(16)13-6-2-1-3-7-13)19(29)23-12-5-4-8-14(9-12)25-17(27)11-22-20(25)30/h1-9,16H,10-11H2,(H2,21,28)(H,22,30)(H,23,29) |
| InChIKey | ARSWZTYCBFDFRL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|