C17H17BrN2O2 — CID 166191130
[6-(2-bromophenoxy)-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 166191130) has the molecular formula C17H17BrN2O2 and a molecular weight of 361.24 g/mol. Its IUPAC name is [6-(2-bromophenoxy)-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [6-(2-bromophenoxy)-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 166191130 |
| Molecular Formula | C17H17BrN2O2 |
| Molecular Weight | 361.24 g/mol |
| Exact Mass | 360.05 |
| IUPAC Name | [6-(2-bromophenoxy)-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(Oc2ccccc2Br)nc1)N1CCCCC1 |
| InChI | InChI=1S/C17H17BrN2O2/c18-14-6-2-3-7-15(14)22-16-9-8-13(12-19-16)17(21)20-10-4-1-5-11-20/h2-3,6-9,12H,1,4-5,10-11H2 |
| InChIKey | MYZURCFVIUIIOO-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.24 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |