C13H20F2N4O — CID 166191537
1-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]butan-1-one (PubChem CID 166191537) has the molecular formula C13H20F2N4O and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]butan-1-one.
| Compound Name | 1-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 166191537 |
| Molecular Formula | C13H20F2N4O |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 1-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCN(Cc2nccn2C(F)F)CC1 |
| InChI | InChI=1S/C13H20F2N4O/c1-2-3-12(20)18-8-6-17(7-9-18)10-11-16-4-5-19(11)13(14)15/h4-5,13H,2-3,6-10H2,1H3 |
| InChIKey | KJLLLAHISRTNHK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |