C12H20F2N4O — CID 111544146
3-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]propan-1-ol (PubChem CID 111544146) has the molecular formula C12H20F2N4O and a molecular weight of 274.31 g/mol. Its IUPAC name is 3-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]propan-1-ol.
| Compound Name | 3-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 111544146 |
| Molecular Formula | C12H20F2N4O |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 3-[4-[[1-(difluoromethyl)imidazol-2-yl]methyl]piperazin-1-yl]propan-1-ol |
| SMILES | OCCCN1CCN(Cc2nccn2C(F)F)CC1 |
| InChI | InChI=1S/C12H20F2N4O/c13-12(14)18-4-2-15-11(18)10-17-7-5-16(6-8-17)3-1-9-19/h2,4,12,19H,1,3,5-10H2 |
| InChIKey | GVGAXIRANITLKK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |