C10H16F2N4 — CID 43144074
1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1,4-diazepane (PubChem CID 43144074) has the molecular formula C10H16F2N4 and a molecular weight of 230.26 g/mol. Its IUPAC name is 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1,4-diazepane.
| Compound Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1,4-diazepane |
|---|---|
| PubChem CID | 43144074 |
| Molecular Formula | C10H16F2N4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-1,4-diazepane |
| SMILES | FC(F)n1ccnc1CN1CCCNCC1 |
| InChI | InChI=1S/C10H16F2N4/c11-10(12)16-7-4-14-9(16)8-15-5-1-2-13-3-6-15/h4,7,10,13H,1-3,5-6,8H2 |
| InChIKey | OCAFGPZTLRTRAZ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |