C16H20F2N4 — CID 124610098
(3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-phenylpiperidin-3-amine (PubChem CID 124610098) has the molecular formula C16H20F2N4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-phenylpiperidin-3-amine.
| Compound Name | (3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-phenylpiperidin-3-amine |
|---|---|
| PubChem CID | 124610098 |
| Molecular Formula | C16H20F2N4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (3S)-1-[[1-(difluoromethyl)imidazol-2-yl]methyl]-N-phenylpiperidin-3-amine |
| SMILES | FC(F)n1ccnc1CN1CCC[C@H](Nc2ccccc2)C1 |
| InChI | InChI=1S/C16H20F2N4/c17-16(18)22-10-8-19-15(22)12-21-9-4-7-14(11-21)20-13-5-2-1-3-6-13/h1-3,5-6,8,10,14,16,20H,4,7,9,11-12H2/t14-/m0/s1 |
| InChIKey | KESIVGTXBQOKBW-AWEZNQCLSA-N |
| XLogP | 3.35 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |