C14H18FN5O3S — CID 166193493
1-[2-fluoro-5-[(2-propan-2-yl-1H-imidazol-5-yl)sulfonylamino]phenyl]-3-methylurea (PubChem CID 166193493) has the molecular formula C14H18FN5O3S and a molecular weight of 355.40 g/mol. Its IUPAC name is 1-[2-fluoro-5-[(2-propan-2-yl-1H-imidazol-5-yl)sulfonylamino]phenyl]-3-methylurea.
| Compound Name | 1-[2-fluoro-5-[(2-propan-2-yl-1H-imidazol-5-yl)sulfonylamino]phenyl]-3-methylurea |
|---|---|
| PubChem CID | 166193493 |
| Molecular Formula | C14H18FN5O3S |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 1-[2-fluoro-5-[(2-propan-2-yl-1H-imidazol-5-yl)sulfonylamino]phenyl]-3-methylurea |
| SMILES | CNC(=O)Nc1cc(NS(=O)(=O)c2cnc(C(C)C)[nH]2)ccc1F |
| InChI | InChI=1S/C14H18FN5O3S/c1-8(2)13-17-7-12(19-13)24(22,23)20-9-4-5-10(15)11(6-9)18-14(21)16-3/h4-8,20H,1-3H3,(H,17,19)(H2,16,18,21) |
| InChIKey | JNWVFZYMGVSINH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 115.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |