C25H24ClN5O2S — CID 166194206
2-benzyl-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 166194206) has the molecular formula C25H24ClN5O2S and a molecular weight of 494.02 g/mol. Its IUPAC name is 2-benzyl-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | 2-benzyl-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 166194206 |
| Molecular Formula | C25H24ClN5O2S |
| Molecular Weight | 494.02 g/mol |
| Exact Mass | 493.13 |
| IUPAC Name | 2-benzyl-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CN1CCN(c2ccc(NC(=O)c3cnc4sc(Cc5ccccc5)cn4c3=O)cc2Cl)CC1 |
| InChI | InChI=1S/C25H24ClN5O2S/c1-29-9-11-30(12-10-29)22-8-7-18(14-21(22)26)28-23(32)20-15-27-25-31(24(20)33)16-19(34-25)13-17-5-3-2-4-6-17/h2-8,14-16H,9-13H2,1H3,(H,28,32) |
| InChIKey | KTTWUHHBBSSGCM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 69.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.02 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|