C23H26ClN5O — CID 86875192
1-benzyl-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-5-methylpyrazole-4-carboxamide (PubChem CID 86875192) has the molecular formula C23H26ClN5O and a molecular weight of 423.95 g/mol. Its IUPAC name is 1-benzyl-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-5-methylpyrazole-4-carboxamide.
| Compound Name | 1-benzyl-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-5-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 86875192 |
| Molecular Formula | C23H26ClN5O |
| Molecular Weight | 423.95 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-benzyl-N-[3-chloro-4-(4-methylpiperazin-1-yl)phenyl]-5-methylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(N3CCN(C)CC3)c(Cl)c2)cnn1Cc1ccccc1 |
| InChI | InChI=1S/C23H26ClN5O/c1-17-20(15-25-29(17)16-18-6-4-3-5-7-18)23(30)26-19-8-9-22(21(24)14-19)28-12-10-27(2)11-13-28/h3-9,14-15H,10-13,16H2,1-2H3,(H,26,30) |
| InChIKey | YVVGQSGEYKZBHP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.95 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|