C22H25ClN6O — CID 167891005
N-[4-(4-benzylpiperazin-1-yl)-3-chlorophenyl]-3-ethyltriazole-4-carboxamide (PubChem CID 167891005) has the molecular formula C22H25ClN6O and a molecular weight of 424.94 g/mol. Its IUPAC name is N-[4-(4-benzylpiperazin-1-yl)-3-chlorophenyl]-3-ethyltriazole-4-carboxamide.
| Compound Name | N-[4-(4-benzylpiperazin-1-yl)-3-chlorophenyl]-3-ethyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 167891005 |
| Molecular Formula | C22H25ClN6O |
| Molecular Weight | 424.94 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-[4-(4-benzylpiperazin-1-yl)-3-chlorophenyl]-3-ethyltriazole-4-carboxamide |
| SMILES | CCn1nncc1C(=O)Nc1ccc(N2CCN(Cc3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C22H25ClN6O/c1-2-29-21(15-24-26-29)22(30)25-18-8-9-20(19(23)14-18)28-12-10-27(11-13-28)16-17-6-4-3-5-7-17/h3-9,14-15H,2,10-13,16H2,1H3,(H,25,30) |
| InChIKey | VUSZWFNGLMFIHV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.94 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|