C18H25N5O2 — CID 142648033
ethyl 3-[2-(4-benzylpiperazin-1-yl)ethyl]triazole-4-carboxylate (PubChem CID 142648033) has the molecular formula C18H25N5O2 and a molecular weight of 343.43 g/mol. Its IUPAC name is ethyl 3-[2-(4-benzylpiperazin-1-yl)ethyl]triazole-4-carboxylate.
| Compound Name | ethyl 3-[2-(4-benzylpiperazin-1-yl)ethyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 142648033 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | ethyl 3-[2-(4-benzylpiperazin-1-yl)ethyl]triazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnnn1CCN1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H25N5O2/c1-2-25-18(24)17-14-19-20-23(17)13-12-21-8-10-22(11-9-21)15-16-6-4-3-5-7-16/h3-7,14H,2,8-13,15H2,1H3 |
| InChIKey | CFEPKWCZTHTCQS-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |