C25H25ClN6O2 — CID 167854806
1-(2,1,3-benzoxadiazol-5-ylmethyl)-3-[4-(4-benzylpiperazin-1-yl)-3-chlorophenyl]urea (PubChem CID 167854806) has the molecular formula C25H25ClN6O2 and a molecular weight of 476.97 g/mol. Its IUPAC name is 1-(2,1,3-benzoxadiazol-5-ylmethyl)-3-[4-(4-benzylpiperazin-1-yl)-3-chlorophenyl]urea.
| Compound Name | 1-(2,1,3-benzoxadiazol-5-ylmethyl)-3-[4-(4-benzylpiperazin-1-yl)-3-chlorophenyl]urea |
|---|---|
| PubChem CID | 167854806 |
| Molecular Formula | C25H25ClN6O2 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 1-(2,1,3-benzoxadiazol-5-ylmethyl)-3-[4-(4-benzylpiperazin-1-yl)-3-chlorophenyl]urea |
| SMILES | O=C(NCc1ccc2nonc2c1)Nc1ccc(N2CCN(Cc3ccccc3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C25H25ClN6O2/c26-21-15-20(28-25(33)27-16-19-6-8-22-23(14-19)30-34-29-22)7-9-24(21)32-12-10-31(11-13-32)17-18-4-2-1-3-5-18/h1-9,14-15H,10-13,16-17H2,(H2,27,28,33) |
| InChIKey | BVCFNZSBMMKFGP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 86.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|