C22H25N3O5S — CID 166194281
(8-methyl-3,4-dihydro-2H-quinolin-1-yl)-[1-(4-nitrophenyl)sulfonylpiperidin-3-yl]methanone (PubChem CID 166194281) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is (8-methyl-3,4-dihydro-2H-quinolin-1-yl)-[1-(4-nitrophenyl)sulfonylpiperidin-3-yl]methanone.
| Compound Name | (8-methyl-3,4-dihydro-2H-quinolin-1-yl)-[1-(4-nitrophenyl)sulfonylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 166194281 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | (8-methyl-3,4-dihydro-2H-quinolin-1-yl)-[1-(4-nitrophenyl)sulfonylpiperidin-3-yl]methanone |
| SMILES | Cc1cccc2c1N(C(=O)C1CCCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)C1)CCC2 |
| InChI | InChI=1S/C22H25N3O5S/c1-16-5-2-6-17-7-4-14-24(21(16)17)22(26)18-8-3-13-23(15-18)31(29,30)20-11-9-19(10-12-20)25(27)28/h2,5-6,9-12,18H,3-4,7-8,13-15H2,1H3 |
| InChIKey | RDDJETHPUYDBTQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|