C15H18N2OS — CID 166195588
5-(4-methylphenyl)-N-(1,3-thiazol-5-yl)pentanamide (PubChem CID 166195588) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is 5-(4-methylphenyl)-N-(1,3-thiazol-5-yl)pentanamide.
| Compound Name | 5-(4-methylphenyl)-N-(1,3-thiazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 166195588 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 5-(4-methylphenyl)-N-(1,3-thiazol-5-yl)pentanamide |
| SMILES | Cc1ccc(CCCCC(=O)Nc2cncs2)cc1 |
| InChI | InChI=1S/C15H18N2OS/c1-12-6-8-13(9-7-12)4-2-3-5-14(18)17-15-10-16-11-19-15/h6-11H,2-5H2,1H3,(H,17,18) |
| InChIKey | VPTYARBDLPBXTQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|