C21H26N2O2S — CID 166195680
3-cyclopropyl-N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiophene-2-carboxamide (PubChem CID 166195680) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 3-cyclopropyl-N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiophene-2-carboxamide.
| Compound Name | 3-cyclopropyl-N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 166195680 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 3-cyclopropyl-N-[2-(3-methoxyphenyl)-2-pyrrolidin-1-ylethyl]thiophene-2-carboxamide |
| SMILES | COc1cccc(C(CNC(=O)c2sccc2C2CC2)N2CCCC2)c1 |
| InChI | InChI=1S/C21H26N2O2S/c1-25-17-6-4-5-16(13-17)19(23-10-2-3-11-23)14-22-21(24)20-18(9-12-26-20)15-7-8-15/h4-6,9,12-13,15,19H,2-3,7-8,10-11,14H2,1H3,(H,22,24) |
| InChIKey | MCLKUEPBPCYOPR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |