C20H19NO5 — CID 166197032
propyl 2-[2-(2-cyanophenoxy)acetyl]oxy-2-phenylacetate (PubChem CID 166197032) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is propyl 2-[2-(2-cyanophenoxy)acetyl]oxy-2-phenylacetate.
| Compound Name | propyl 2-[2-(2-cyanophenoxy)acetyl]oxy-2-phenylacetate |
|---|---|
| PubChem CID | 166197032 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | propyl 2-[2-(2-cyanophenoxy)acetyl]oxy-2-phenylacetate |
| SMILES | CCCOC(=O)C(OC(=O)COc1ccccc1C#N)c1ccccc1 |
| InChI | InChI=1S/C20H19NO5/c1-2-12-24-20(23)19(15-8-4-3-5-9-15)26-18(22)14-25-17-11-7-6-10-16(17)13-21/h3-11,19H,2,12,14H2,1H3 |
| InChIKey | KBEWCGMXDTTWIO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |