C22H26N4O2 — CID 166197770
(2E,4E)-1,6-bis(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexa-2,4-diene-1,6-dione (PubChem CID 166197770) has the molecular formula C22H26N4O2 and a molecular weight of 378.48 g/mol. Its IUPAC name is (2E,4E)-1,6-bis(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexa-2,4-diene-1,6-dione.
| Compound Name | (2E,4E)-1,6-bis(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexa-2,4-diene-1,6-dione |
|---|---|
| PubChem CID | 166197770 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | (2E,4E)-1,6-bis(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)hexa-2,4-diene-1,6-dione |
| SMILES | CC1c2cccn2CCN1C(=O)/C=C/C=C/C(=O)N1CCn2cccc2C1C |
| InChI | InChI=1S/C22H26N4O2/c1-17-19-7-5-11-23(19)13-15-25(17)21(27)9-3-4-10-22(28)26-16-14-24-12-6-8-20(24)18(26)2/h3-12,17-18H,13-16H2,1-2H3/b9-3+,10-4+ |
| InChIKey | NLDLPYVWGSRQKZ-LQIBPGRFSA-N |
| XLogP | 2.91 |
| TPSA | 50.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|