C15H16N2OS — CID 71897647
1-(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 71897647) has the molecular formula C15H16N2OS and a molecular weight of 272.37 g/mol. Its IUPAC name is 1-(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | 1-(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 71897647 |
| Molecular Formula | C15H16N2OS |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 1-(1-methyl-3,4-dihydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | CC1c2cccn2CCN1C(=O)C=Cc1cccs1 |
| InChI | InChI=1S/C15H16N2OS/c1-12-14-5-2-8-16(14)9-10-17(12)15(18)7-6-13-4-3-11-19-13/h2-8,11-12H,9-10H2,1H3 |
| InChIKey | PASNKLUNTCSRJL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|