C11H13NOS2 — CID 122331674
(E)-1-(2-methyl-1,3-thiazolidin-3-yl)-3-thiophen-2-ylprop-2-en-1-one (PubChem CID 122331674) has the molecular formula C11H13NOS2 and a molecular weight of 239.37 g/mol. Its IUPAC name is (E)-1-(2-methyl-1,3-thiazolidin-3-yl)-3-thiophen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-(2-methyl-1,3-thiazolidin-3-yl)-3-thiophen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 122331674 |
| Molecular Formula | C11H13NOS2 |
| Molecular Weight | 239.37 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | (E)-1-(2-methyl-1,3-thiazolidin-3-yl)-3-thiophen-2-ylprop-2-en-1-one |
| SMILES | CC1SCCN1C(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C11H13NOS2/c1-9-12(6-8-14-9)11(13)5-4-10-3-2-7-15-10/h2-5,7,9H,6,8H2,1H3/b5-4+ |
| InChIKey | MTSSOUJVWHIVCB-SNAWJCMRSA-N |
| XLogP | 2.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|