C14H18N2O2S — CID 94197977
(3R,6R)-6-methyl-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidine-3-carboxamide (PubChem CID 94197977) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is (3R,6R)-6-methyl-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidine-3-carboxamide.
| Compound Name | (3R,6R)-6-methyl-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94197977 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (3R,6R)-6-methyl-1-[(E)-3-thiophen-2-ylprop-2-enoyl]piperidine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)/C=C/c1cccs1 |
| InChI | InChI=1S/C14H18N2O2S/c1-10-4-5-11(14(15)18)9-16(10)13(17)7-6-12-3-2-8-19-12/h2-3,6-8,10-11H,4-5,9H2,1H3,(H2,15,18)/b7-6+/t10-,11-/m1/s1 |
| InChIKey | ZUTIABRMTPDGQJ-AFPRHGJPSA-N |
| XLogP | 1.87 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|