C18H21N5O2 — CID 94636261
(3R,6R)-6-methyl-1-[(E)-3-(2-phenyltriazol-4-yl)prop-2-enoyl]piperidine-3-carboxamide (PubChem CID 94636261) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is (3R,6R)-6-methyl-1-[(E)-3-(2-phenyltriazol-4-yl)prop-2-enoyl]piperidine-3-carboxamide.
| Compound Name | (3R,6R)-6-methyl-1-[(E)-3-(2-phenyltriazol-4-yl)prop-2-enoyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94636261 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (3R,6R)-6-methyl-1-[(E)-3-(2-phenyltriazol-4-yl)prop-2-enoyl]piperidine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@@H](C(N)=O)CN1C(=O)/C=C/c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H21N5O2/c1-13-7-8-14(18(19)25)12-22(13)17(24)10-9-15-11-20-23(21-15)16-5-3-2-4-6-16/h2-6,9-11,13-14H,7-8,12H2,1H3,(H2,19,25)/b10-9+/t13-,14-/m1/s1 |
| InChIKey | DMBBKXPNDBASQS-NPUYYSGSSA-N |
| XLogP | 1.39 |
| TPSA | 94.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|