C17H21ClN2O3 — CID 56819172
1-[(E)-3-(5-chloro-2-methoxyphenyl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide (PubChem CID 56819172) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is 1-[(E)-3-(5-chloro-2-methoxyphenyl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | 1-[(E)-3-(5-chloro-2-methoxyphenyl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 56819172 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 1-[(E)-3-(5-chloro-2-methoxyphenyl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide |
| SMILES | COc1ccc(Cl)cc1/C=C/C(=O)N1CC(C(N)=O)CCC1C |
| InChI | InChI=1S/C17H21ClN2O3/c1-11-3-4-13(17(19)22)10-20(11)16(21)8-5-12-9-14(18)6-7-15(12)23-2/h5-9,11,13H,3-4,10H2,1-2H3,(H2,19,22)/b8-5+ |
| InChIKey | IPEMLKLTSDXZQX-VMPITWQZSA-N |
| XLogP | 2.47 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|