C17H19N3O2 — CID 95581613
(3S,6R)-1-[(E)-3-(2-cyanophenyl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide (PubChem CID 95581613) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is (3S,6R)-1-[(E)-3-(2-cyanophenyl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | (3S,6R)-1-[(E)-3-(2-cyanophenyl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 95581613 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | (3S,6R)-1-[(E)-3-(2-cyanophenyl)prop-2-enoyl]-6-methylpiperidine-3-carboxamide |
| SMILES | C[C@@H]1CC[C@H](C(N)=O)CN1C(=O)/C=C/c1ccccc1C#N |
| InChI | InChI=1S/C17H19N3O2/c1-12-6-7-15(17(19)22)11-20(12)16(21)9-8-13-4-2-3-5-14(13)10-18/h2-5,8-9,12,15H,6-7,11H2,1H3,(H2,19,22)/b9-8+/t12-,15+/m1/s1 |
| InChIKey | ONDUWICZUDQBPB-XWPAEANOSA-N |
| XLogP | 1.68 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|