About 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one
1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one (PubChem CID 166198152) has the molecular formula C20H22BrNO
and a molecular weight of 372.31 g/mol. Its IUPAC name is 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one.
Molecular Properties
| Compound Name | 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one |
| PubChem CID | 166198152 |
| Molecular Formula | C20H22BrNO |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one |
| SMILES | Cc1cc(Br)cc2c1CN(C(=O)CC(C)c1ccccc1)CC2 |
| InChI | InChI=1S/C20H22BrNO/c1-14(16-6-4-3-5-7-16)11-20(23)22-9-8-17-12-18(21)10-15(2)19(17)13-22/h3-7,10,12,14H,8-9,11,13H2,1-2H3 |
| InChIKey | CRWZXBWMOMYWEE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one?
The IUPAC name of 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one (CID 166198152) is 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one.
What is the SMILES notation for 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one?
The canonical SMILES for 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one is Cc1cc(Br)cc2c1CN(C(=O)CC(C)c1ccccc1)CC2.
What is the InChIKey of 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one?
The InChIKey is CRWZXBWMOMYWEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22BrNO/c1-14(16-6-4-3-5-7-16)11-20(23)22-9-8-17-12-18(21)10-15(2)19(17)13-22/h3-7,10,12,14H,8-9,11,13H2,1-2H3.
What are the key properties of 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one?
1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one has a molecular weight of 372.31 g/mol, XLogP of 4.84, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-bromo-8-methyl-3,4-dihydro-1H-isoquinolin-2-yl)-3-phenylbutan-1-one is sourced from PubChem (CID 166198152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).