C18H29N9 — CID 166198990
4-N-butyl-6-[4-[2-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]pyrimidine-2,4-diamine (PubChem CID 166198990) has the molecular formula C18H29N9 and a molecular weight of 371.49 g/mol. Its IUPAC name is 4-N-butyl-6-[4-[2-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-6-[4-[2-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 166198990 |
| Molecular Formula | C18H29N9 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 4-N-butyl-6-[4-[2-(dimethylamino)pyrimidin-4-yl]piperazin-1-yl]pyrimidine-2,4-diamine |
| SMILES | CCCCNc1cc(N2CCN(c3ccnc(N(C)C)n3)CC2)nc(N)n1 |
| InChI | InChI=1S/C18H29N9/c1-4-5-7-20-14-13-16(23-17(19)22-14)27-11-9-26(10-12-27)15-6-8-21-18(24-15)25(2)3/h6,8,13H,4-5,7,9-12H2,1-3H3,(H3,19,20,22,23) |
| InChIKey | KOIWQJURSIDVLM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|