C12H14Cl2N4O — CID 166200639
2-[(3,5-dichloro-2-pyridinyl)oxy]-N-[(1-methylimidazol-2-yl)methyl]ethanamine (PubChem CID 166200639) has the molecular formula C12H14Cl2N4O and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-pyridinyl)oxy]-N-[(1-methylimidazol-2-yl)methyl]ethanamine.
| Compound Name | 2-[(3,5-dichloro-2-pyridinyl)oxy]-N-[(1-methylimidazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 166200639 |
| Molecular Formula | C12H14Cl2N4O |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-[(3,5-dichloro-2-pyridinyl)oxy]-N-[(1-methylimidazol-2-yl)methyl]ethanamine |
| SMILES | Cn1ccnc1CNCCOc1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C12H14Cl2N4O/c1-18-4-2-16-11(18)8-15-3-5-19-12-10(14)6-9(13)7-17-12/h2,4,6-7,15H,3,5,8H2,1H3 |
| InChIKey | XYJAEZRHQPMANA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|