C23H26N4O4 — CID 166200662
N-[[4-(dimethylamino)phenyl]methyl]-2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 166200662) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is N-[[4-(dimethylamino)phenyl]methyl]-2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 166200662 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | N-[[4-(dimethylamino)phenyl]methyl]-2-(5,7-dioxopyrrolo[3,4-b]pyridin-6-yl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CN(C)c1ccc(CN(CC2CCCO2)C(=O)CN2C(=O)c3cccnc3C2=O)cc1 |
| InChI | InChI=1S/C23H26N4O4/c1-25(2)17-9-7-16(8-10-17)13-26(14-18-5-4-12-31-18)20(28)15-27-22(29)19-6-3-11-24-21(19)23(27)30/h3,6-11,18H,4-5,12-15H2,1-2H3 |
| InChIKey | WZJWGYYYJAUYEX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|