C26H30ClN3O3 — CID 75866466
3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[[4-(dimethylamino)phenyl]methyl]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 75866466) has the molecular formula C26H30ClN3O3 and a molecular weight of 468.00 g/mol. Its IUPAC name is 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[[4-(dimethylamino)phenyl]methyl]-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[[4-(dimethylamino)phenyl]methyl]-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 75866466 |
| Molecular Formula | C26H30ClN3O3 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 3-[5-(2-chlorophenyl)-1,3-oxazol-2-yl]-N-[[4-(dimethylamino)phenyl]methyl]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | CN(C)c1ccc(CN(CC2CCCO2)C(=O)CCc2ncc(-c3ccccc3Cl)o2)cc1 |
| InChI | InChI=1S/C26H30ClN3O3/c1-29(2)20-11-9-19(10-12-20)17-30(18-21-6-5-15-32-21)26(31)14-13-25-28-16-24(33-25)22-7-3-4-8-23(22)27/h3-4,7-12,16,21H,5-6,13-15,17-18H2,1-2H3 |
| InChIKey | ASJGNCIIXAQHAF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|