C25H26FN3O3 — CID 166201596
[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 3-isoquinolin-4-yl-2-methylpropanoate (PubChem CID 166201596) has the molecular formula C25H26FN3O3 and a molecular weight of 435.50 g/mol. Its IUPAC name is [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 3-isoquinolin-4-yl-2-methylpropanoate.
| Compound Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 3-isoquinolin-4-yl-2-methylpropanoate |
|---|---|
| PubChem CID | 166201596 |
| Molecular Formula | C25H26FN3O3 |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 3-isoquinolin-4-yl-2-methylpropanoate |
| SMILES | CC(Cc1cncc2ccccc12)C(=O)OCC(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C25H26FN3O3/c1-18(14-20-16-27-15-19-4-2-3-5-23(19)20)25(31)32-17-24(30)29-12-10-28(11-13-29)22-8-6-21(26)7-9-22/h2-9,15-16,18H,10-14,17H2,1H3 |
| InChIKey | JZBCAXMWEWRZGL-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |