C27H26FN3O4 — CID 46666500
[2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-benzamido-2-phenylacetate (PubChem CID 46666500) has the molecular formula C27H26FN3O4 and a molecular weight of 475.52 g/mol. Its IUPAC name is [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-benzamido-2-phenylacetate.
| Compound Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-benzamido-2-phenylacetate |
|---|---|
| PubChem CID | 46666500 |
| Molecular Formula | C27H26FN3O4 |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | [2-[4-(4-fluorophenyl)piperazin-1-yl]-2-oxoethyl] 2-benzamido-2-phenylacetate |
| SMILES | O=C(NC(C(=O)OCC(=O)N1CCN(c2ccc(F)cc2)CC1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26FN3O4/c28-22-11-13-23(14-12-22)30-15-17-31(18-16-30)24(32)19-35-27(34)25(20-7-3-1-4-8-20)29-26(33)21-9-5-2-6-10-21/h1-14,25H,15-19H2,(H,29,33) |
| InChIKey | CMMDNFYLQYLVML-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |