C14H12FN7O — CID 166202519
3-[(2E)-2-[(3-fluoro-4-pyrazol-1-ylphenyl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 166202519) has the molecular formula C14H12FN7O and a molecular weight of 313.30 g/mol. Its IUPAC name is 3-[(2E)-2-[(3-fluoro-4-pyrazol-1-ylphenyl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-[(2E)-2-[(3-fluoro-4-pyrazol-1-ylphenyl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 166202519 |
| Molecular Formula | C14H12FN7O |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-[(2E)-2-[(3-fluoro-4-pyrazol-1-ylphenyl)methylidene]hydrazinyl]-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(N/N=C/c2ccc(-n3cccn3)c(F)c2)[nH]c1=O |
| InChI | InChI=1S/C14H12FN7O/c1-9-13(23)18-14(21-19-9)20-16-8-10-3-4-12(11(15)7-10)22-6-2-5-17-22/h2-8H,1H3,(H2,18,20,21,23)/b16-8+ |
| InChIKey | DEBHKNHYSNIZEH-LZYBPNLTSA-N |
| XLogP | 1.24 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.30 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|