C24H29N5O — CID 166204814
(E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-[4-(1H-imidazol-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 166204814) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is (E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-[4-(1H-imidazol-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-[4-(1H-imidazol-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 166204814 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (E)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-1-[4-(1H-imidazol-2-ylmethyl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(-n2c(C)cc(/C=C/C(=O)N3CCN(Cc4ncc[nH]4)CC3)c2C)cc1 |
| InChI | InChI=1S/C24H29N5O/c1-18-4-7-22(8-5-18)29-19(2)16-21(20(29)3)6-9-24(30)28-14-12-27(13-15-28)17-23-25-10-11-26-23/h4-11,16H,12-15,17H2,1-3H3,(H,25,26)/b9-6+ |
| InChIKey | KSSRORCKGOCQSO-RMKNXTFCSA-N |
| XLogP | 3.48 |
| TPSA | 57.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|