C25H32N4O3 — CID 55461361
2-[4-[3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide (PubChem CID 55461361) has the molecular formula C25H32N4O3 and a molecular weight of 436.56 g/mol. Its IUPAC name is 2-[4-[3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 55461361 |
| Molecular Formula | C25H32N4O3 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | 2-[4-[3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enoyl]piperazin-1-yl]-2-oxo-N-propan-2-ylacetamide |
| SMILES | Cc1ccc(-n2c(C)cc(C=CC(=O)N3CCN(C(=O)C(=O)NC(C)C)CC3)c2C)cc1 |
| InChI | InChI=1S/C25H32N4O3/c1-17(2)26-24(31)25(32)28-14-12-27(13-15-28)23(30)11-8-21-16-19(4)29(20(21)5)22-9-6-18(3)7-10-22/h6-11,16-17H,12-15H2,1-5H3,(H,26,31) |
| InChIKey | DMACKHVMKKMBSA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 74.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|