About (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate
(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate (PubChem CID 166205150) has the molecular formula C14H12N4O3
and a molecular weight of 284.27 g/mol. Its IUPAC name is (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate.
Molecular Properties
| Compound Name | (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate |
| PubChem CID | 166205150 |
| Molecular Formula | C14H12N4O3 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate |
| SMILES | O=C(OCc1nc(C2CC2)no1)c1n[nH]c2ccccc12 |
| InChI | InChI=1S/C14H12N4O3/c19-14(12-9-3-1-2-4-10(9)16-17-12)20-7-11-15-13(18-21-11)8-5-6-8/h1-4,8H,5-7H2,(H,16,17) |
| InChIKey | WSZQGXSQWQEBGZ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate?
The IUPAC name of (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate (CID 166205150) is (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate.
What is the SMILES notation for (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate?
The canonical SMILES for (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate is O=C(OCc1nc(C2CC2)no1)c1n[nH]c2ccccc12.
What is the InChIKey of (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate?
The InChIKey is WSZQGXSQWQEBGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N4O3/c19-14(12-9-3-1-2-4-10(9)16-17-12)20-7-11-15-13(18-21-11)8-5-6-8/h1-4,8H,5-7H2,(H,16,17).
What are the key properties of (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate?
(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate has a molecular weight of 284.27 g/mol, XLogP of 2.18, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl 1H-indazole-3-carboxylate is sourced from PubChem (CID 166205150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).