C24H26N4O4 — CID 166205715
N-[[4-methyl-2-(oxolan-3-ylmethoxy)phenyl]methyl]-N'-[4-(1H-pyrazol-5-yl)phenyl]oxamide (PubChem CID 166205715) has the molecular formula C24H26N4O4 and a molecular weight of 434.50 g/mol. Its IUPAC name is N-[[4-methyl-2-(oxolan-3-ylmethoxy)phenyl]methyl]-N'-[4-(1H-pyrazol-5-yl)phenyl]oxamide.
| Compound Name | N-[[4-methyl-2-(oxolan-3-ylmethoxy)phenyl]methyl]-N'-[4-(1H-pyrazol-5-yl)phenyl]oxamide |
|---|---|
| PubChem CID | 166205715 |
| Molecular Formula | C24H26N4O4 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[[4-methyl-2-(oxolan-3-ylmethoxy)phenyl]methyl]-N'-[4-(1H-pyrazol-5-yl)phenyl]oxamide |
| SMILES | Cc1ccc(CNC(=O)C(=O)Nc2ccc(-c3ccn[nH]3)cc2)c(OCC2CCOC2)c1 |
| InChI | InChI=1S/C24H26N4O4/c1-16-2-3-19(22(12-16)32-15-17-9-11-31-14-17)13-25-23(29)24(30)27-20-6-4-18(5-7-20)21-8-10-26-28-21/h2-8,10,12,17H,9,11,13-15H2,1H3,(H,25,29)(H,26,28)(H,27,30) |
| InChIKey | HDGFXEHSQXNXFD-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 105.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|