C19H21N3O2 — CID 97070107
6-[[4-methyl-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]methylamino]pyridine-3-carbonitrile (PubChem CID 97070107) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 6-[[4-methyl-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]methylamino]pyridine-3-carbonitrile.
| Compound Name | 6-[[4-methyl-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]methylamino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 97070107 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 6-[[4-methyl-2-[[(3S)-oxolan-3-yl]methoxy]phenyl]methylamino]pyridine-3-carbonitrile |
| SMILES | Cc1ccc(CNc2ccc(C#N)cn2)c(OC[C@H]2CCOC2)c1 |
| InChI | InChI=1S/C19H21N3O2/c1-14-2-4-17(11-22-19-5-3-15(9-20)10-21-19)18(8-14)24-13-16-6-7-23-12-16/h2-5,8,10,16H,6-7,11-13H2,1H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | RIXQONVUMAITMD-INIZCTEOSA-N |
| XLogP | 3.29 |
| TPSA | 67.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |