C17H18N4O2 — CID 133491288
5-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methylamino]pyrazine-2-carbonitrile (PubChem CID 133491288) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 5-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methylamino]pyrazine-2-carbonitrile.
| Compound Name | 5-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methylamino]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133491288 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 5-[[4-methyl-2-(oxolan-3-yloxy)phenyl]methylamino]pyrazine-2-carbonitrile |
| SMILES | Cc1ccc(CNc2cnc(C#N)cn2)c(OC2CCOC2)c1 |
| InChI | InChI=1S/C17H18N4O2/c1-12-2-3-13(16(6-12)23-15-4-5-22-11-15)8-20-17-10-19-14(7-18)9-21-17/h2-3,6,9-10,15H,4-5,8,11H2,1H3,(H,20,21) |
| InChIKey | WINHZYCLRULNBO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 80.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |