C18H19N3O3 — CID 97224334
4-cyano-N-[[4-methyl-2-[(3S)-oxolan-3-yl]oxyphenyl]methyl]-1H-pyrrole-2-carboxamide (PubChem CID 97224334) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 4-cyano-N-[[4-methyl-2-[(3S)-oxolan-3-yl]oxyphenyl]methyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-cyano-N-[[4-methyl-2-[(3S)-oxolan-3-yl]oxyphenyl]methyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97224334 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 4-cyano-N-[[4-methyl-2-[(3S)-oxolan-3-yl]oxyphenyl]methyl]-1H-pyrrole-2-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cc(C#N)c[nH]2)c(O[C@H]2CCOC2)c1 |
| InChI | InChI=1S/C18H19N3O3/c1-12-2-3-14(17(6-12)24-15-4-5-23-11-15)10-21-18(22)16-7-13(8-19)9-20-16/h2-3,6-7,9,15,20H,4-5,10-11H2,1H3,(H,21,22)/t15-/m0/s1 |
| InChIKey | DMJIFOYNXRUMOO-HNNXBMFYSA-N |
| XLogP | 2.29 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |